C29H34N2O4S2 — CID 123444311
3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123444311) has the molecular formula C29H34N2O4S2 and a molecular weight of 538.74 g/mol. Its IUPAC name is 3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123444311 |
| Molecular Formula | C29H34N2O4S2 |
| Molecular Weight | 538.74 g/mol |
| Exact Mass | 538.20 |
| IUPAC Name | 3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)cc(-c2cc(CCCN)c(C=C3SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)o2)c1 |
| InChI | InChI=1S/C29H34N2O4S2/c1-33-22-11-19(12-23(14-22)34-2)24-13-18(4-3-5-30)25(35-24)15-26-28(32)31(29(36)37-26)27-20-7-16-6-17(9-20)10-21(27)8-16/h11-17,20-21,27H,3-10,30H2,1-2H3 |
| InChIKey | WAEBARAPZJWTCQ-UHFFFAOYSA-N |
| XLogP | 5.88 |
| TPSA | 77.93 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 538.74 |
| LogP ≤ 5 | 5.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|