C32H39NO5S2 — CID 89485107
(5Z)-3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(6-hydroxyhexyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89485107) has the molecular formula C32H39NO5S2 and a molecular weight of 581.80 g/mol. Its IUPAC name is (5Z)-3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(6-hydroxyhexyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(6-hydroxyhexyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89485107 |
| Molecular Formula | C32H39NO5S2 |
| Molecular Weight | 581.80 g/mol |
| Exact Mass | 581.23 |
| IUPAC Name | (5Z)-3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-(6-hydroxyhexyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)cc(-c2cc(CCCCCCO)c(/C=C3\SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)o2)c1 |
| InChI | InChI=1S/C32H39NO5S2/c1-36-25-14-22(15-26(17-25)37-2)27-16-21(7-5-3-4-6-8-34)28(38-27)18-29-31(35)33(32(39)40-29)30-23-10-19-9-20(12-23)13-24(30)11-19/h14-20,23-24,30,34H,3-13H2,1-2H3/b29-18- |
| InChIKey | PUBMYNWZJXBMPH-MIXAMLLLSA-N |
| XLogP | 7.08 |
| TPSA | 72.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.80 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|