C28H31NO4S2 — CID 123494864
3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-ethylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123494864) has the molecular formula C28H31NO4S2 and a molecular weight of 509.69 g/mol. Its IUPAC name is 3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-ethylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-ethylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123494864 |
| Molecular Formula | C28H31NO4S2 |
| Molecular Weight | 509.69 g/mol |
| Exact Mass | 509.17 |
| IUPAC Name | 3-(2-adamantyl)-5-[[5-(3,5-dimethoxyphenyl)-3-ethylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | CCc1cc(-c2cc(OC)cc(OC)c2)oc1C=C1SC(=S)N(C2C3CC4CC(C3)CC2C4)C1=O |
| InChI | InChI=1S/C28H31NO4S2/c1-4-17-12-23(18-10-21(31-2)13-22(11-18)32-3)33-24(17)14-25-27(30)29(28(34)35-25)26-19-6-15-5-16(8-19)9-20(26)7-15/h10-16,19-20,26H,4-9H2,1-3H3 |
| InChIKey | BKJCDAHTLDXODZ-UHFFFAOYSA-N |
| XLogP | 6.55 |
| TPSA | 51.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 509.69 |
| LogP ≤ 5 | 6.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|