C25H25NO3S2 — CID 88546372
(5E)-3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 88546372) has the molecular formula C25H25NO3S2 and a molecular weight of 451.61 g/mol. Its IUPAC name is (5E)-3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5E)-3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 88546372 |
| Molecular Formula | C25H25NO3S2 |
| Molecular Weight | 451.61 g/mol |
| Exact Mass | 451.13 |
| IUPAC Name | (5E)-3-(2-adamantyl)-5-[[3-(hydroxymethyl)-5-phenylfuran-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1/C(=C\c2oc(-c3ccccc3)cc2CO)SC(=S)N1C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C25H25NO3S2/c27-13-19-11-20(16-4-2-1-3-5-16)29-21(19)12-22-24(28)26(25(30)31-22)23-17-7-14-6-15(9-17)10-18(23)8-14/h1-5,11-12,14-15,17-18,23,27H,6-10,13H2/b22-12+ |
| InChIKey | QZCVNRYWYOAXMQ-WSDLNYQXSA-N |
| XLogP | 5.46 |
| TPSA | 53.68 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 451.61 |
| LogP ≤ 5 | 5.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|