C31H35FN2O3S2 — CID 123217730
3-(2-adamantyl)-5-[[5-(4-fluorophenyl)-3-(3-morpholin-4-ylpropyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123217730) has the molecular formula C31H35FN2O3S2 and a molecular weight of 566.76 g/mol. Its IUPAC name is 3-(2-adamantyl)-5-[[5-(4-fluorophenyl)-3-(3-morpholin-4-ylpropyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-adamantyl)-5-[[5-(4-fluorophenyl)-3-(3-morpholin-4-ylpropyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123217730 |
| Molecular Formula | C31H35FN2O3S2 |
| Molecular Weight | 566.76 g/mol |
| Exact Mass | 566.21 |
| IUPAC Name | 3-(2-adamantyl)-5-[[5-(4-fluorophenyl)-3-(3-morpholin-4-ylpropyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | O=C1C(=Cc2oc(-c3ccc(F)cc3)cc2CCCN2CCOCC2)SC(=S)N1C1C2CC3CC(C2)CC1C3 |
| InChI | InChI=1S/C31H35FN2O3S2/c32-25-5-3-21(4-6-25)26-17-22(2-1-7-33-8-10-36-11-9-33)27(37-26)18-28-30(35)34(31(38)39-28)29-23-13-19-12-20(15-23)16-24(29)14-19/h3-6,17-20,23-24,29H,1-2,7-16H2 |
| InChIKey | ZJPWKBJXPWNROW-UHFFFAOYSA-N |
| XLogP | 6.38 |
| TPSA | 45.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.76 |
| LogP ≤ 5 | 6.38 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|