C31H35NO6S2 — CID 88545741
3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl acetate (PubChem CID 88545741) has the molecular formula C31H35NO6S2 and a molecular weight of 581.76 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl acetate.
| Compound Name | 3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl acetate |
|---|---|
| PubChem CID | 88545741 |
| Molecular Formula | C31H35NO6S2 |
| Molecular Weight | 581.76 g/mol |
| Exact Mass | 581.19 |
| IUPAC Name | 3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl acetate |
| SMILES | COc1cc(OC)cc(-c2cc(CCCOC(C)=O)c(/C=C3\SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)o2)c1 |
| InChI | InChI=1S/C31H35NO6S2/c1-17(33)37-6-4-5-20-14-26(21-12-24(35-2)15-25(13-21)36-3)38-27(20)16-28-30(34)32(31(39)40-28)29-22-8-18-7-19(10-22)11-23(29)9-18/h12-16,18-19,22-23,29H,4-11H2,1-3H3/b28-16- |
| InChIKey | VSODNQBFSAGMBW-NTFVMDSBSA-N |
| XLogP | 6.49 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 581.76 |
| LogP ≤ 5 | 6.49 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|