C35H44N4O6S2 — CID 89491418
tert-butyl N-[N'-[3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]carbamimidoyl]carbamate (PubChem CID 89491418) has the molecular formula C35H44N4O6S2 and a molecular weight of 680.89 g/mol. Its IUPAC name is tert-butyl N-[N'-[3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]carbamimidoyl]carbamate.
| Compound Name | tert-butyl N-[N'-[3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]carbamimidoyl]carbamate |
|---|---|
| PubChem CID | 89491418 |
| Molecular Formula | C35H44N4O6S2 |
| Molecular Weight | 680.89 g/mol |
| Exact Mass | 680.27 |
| IUPAC Name | tert-butyl N-[N'-[3-[2-[(Z)-[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl]carbamimidoyl]carbamate |
| SMILES | COc1cc(OC)cc(-c2cc(CCC/N=C(\N)NC(=O)OC(C)(C)C)c(/C=C3\SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)o2)c1 |
| InChI | InChI=1S/C35H44N4O6S2/c1-35(2,3)45-33(41)38-32(36)37-8-6-7-21-16-27(22-14-25(42-4)17-26(15-22)43-5)44-28(21)18-29-31(40)39(34(46)47-29)30-23-10-19-9-20(12-23)13-24(30)11-19/h14-20,23-24,30H,6-13H2,1-5H3,(H3,36,37,38,41)/b29-18- |
| InChIKey | TZBGAWAHSBIUTF-MIXAMLLLSA-N |
| XLogP | 6.76 |
| TPSA | 128.62 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 47 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 680.89 |
| LogP ≤ 5 | 6.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|