C30H35N3O7S2 — CID 89485851
3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2,4-diamino-4-oxobutanoate (PubChem CID 89485851) has the molecular formula C30H35N3O7S2 and a molecular weight of 613.76 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2,4-diamino-4-oxobutanoate.
| Compound Name | 3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2,4-diamino-4-oxobutanoate |
|---|---|
| PubChem CID | 89485851 |
| Molecular Formula | C30H35N3O7S2 |
| Molecular Weight | 613.76 g/mol |
| Exact Mass | 613.19 |
| IUPAC Name | 3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2,4-diamino-4-oxobutanoate |
| SMILES | COc1cc(OC)cc(-c2cc(CCCOC(=O)[C@@H](N)CC(N)=O)c(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)c1 |
| InChI | InChI=1S/C30H35N3O7S2/c1-37-20-10-19(11-21(13-20)38-2)24-12-18(4-3-7-39-29(36)22(31)14-27(32)34)25(40-24)15-26-28(35)33(30(41)42-26)23-9-16-5-6-17(23)8-16/h10-13,15-17,22-23H,3-9,14,31H2,1-2H3,(H2,32,34)/b26-15-/t16?,17?,22-,23?/m0/s1 |
| InChIKey | WIZLSTJHXCOKSV-YRHONPNISA-N |
| XLogP | 4.03 |
| TPSA | 147.32 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 42 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 613.76 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|