C36H40N2O5S2 — CID 147301546
(5Z)-5-[[3-[(6S)-6-amino-5-oxo-7-phenylheptyl]-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 147301546) has the molecular formula C36H40N2O5S2 and a molecular weight of 644.86 g/mol. Its IUPAC name is (5Z)-5-[[3-[(6S)-6-amino-5-oxo-7-phenylheptyl]-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-5-[[3-[(6S)-6-amino-5-oxo-7-phenylheptyl]-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 147301546 |
| Molecular Formula | C36H40N2O5S2 |
| Molecular Weight | 644.86 g/mol |
| Exact Mass | 644.24 |
| IUPAC Name | (5Z)-5-[[3-[(6S)-6-amino-5-oxo-7-phenylheptyl]-5-(3,5-dimethoxyphenyl)furan-2-yl]methylidene]-3-(2-bicyclo[2.2.1]heptanyl)-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(OC)cc(-c2cc(CCCCC(=O)[C@@H](N)Cc3ccccc3)c(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)c1 |
| InChI | InChI=1S/C36H40N2O5S2/c1-41-27-17-26(18-28(20-27)42-2)32-19-25(10-6-7-11-31(39)29(37)15-22-8-4-3-5-9-22)33(43-32)21-34-35(40)38(36(44)45-34)30-16-23-12-13-24(30)14-23/h3-5,8-9,17-21,23-24,29-30H,6-7,10-16,37H2,1-2H3/b34-21-/t23?,24?,29-,30?/m0/s1 |
| InChIKey | CWELAWSMLGSTFH-ABUPJXAMSA-N |
| XLogP | 7.21 |
| TPSA | 95.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 45 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 644.86 |
| LogP ≤ 5 | 7.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|