C34H36N2O6S2 — CID 89485121
3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2-amino-2-phenylacetate (PubChem CID 89485121) has the molecular formula C34H36N2O6S2 and a molecular weight of 632.80 g/mol. Its IUPAC name is 3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2-amino-2-phenylacetate.
| Compound Name | 3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2-amino-2-phenylacetate |
|---|---|
| PubChem CID | 89485121 |
| Molecular Formula | C34H36N2O6S2 |
| Molecular Weight | 632.80 g/mol |
| Exact Mass | 632.20 |
| IUPAC Name | 3-[2-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]-5-(3,5-dimethoxyphenyl)furan-3-yl]propyl (2S)-2-amino-2-phenylacetate |
| SMILES | COc1cc(OC)cc(-c2cc(CCCOC(=O)[C@@H](N)c3ccccc3)c(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)c1 |
| InChI | InChI=1S/C34H36N2O6S2/c1-39-25-15-24(16-26(18-25)40-2)28-17-23(9-6-12-41-33(38)31(35)21-7-4-3-5-8-21)29(42-28)19-30-32(37)36(34(43)44-30)27-14-20-10-11-22(27)13-20/h3-5,7-8,15-20,22,27,31H,6,9-14,35H2,1-2H3/b30-19-/t20?,22?,27?,31-/m0/s1 |
| InChIKey | RHFLZIOCPNIYOJ-NOTYSOAPSA-N |
| XLogP | 6.53 |
| TPSA | 104.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 632.80 |
| LogP ≤ 5 | 6.53 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|