C32H32N2O5S2 — CID 89491281
2-[3-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-5-methoxyphenoxy]-N-(2-phenylethyl)acetamide (PubChem CID 89491281) has the molecular formula C32H32N2O5S2 and a molecular weight of 588.75 g/mol. Its IUPAC name is 2-[3-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-5-methoxyphenoxy]-N-(2-phenylethyl)acetamide.
| Compound Name | 2-[3-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-5-methoxyphenoxy]-N-(2-phenylethyl)acetamide |
|---|---|
| PubChem CID | 89491281 |
| Molecular Formula | C32H32N2O5S2 |
| Molecular Weight | 588.75 g/mol |
| Exact Mass | 588.18 |
| IUPAC Name | 2-[3-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-5-methoxyphenoxy]-N-(2-phenylethyl)acetamide |
| SMILES | COc1cc(OCC(=O)NCCc2ccccc2)cc(-c2ccc(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)c1 |
| InChI | InChI=1S/C32H32N2O5S2/c1-37-25-15-23(16-26(17-25)38-19-30(35)33-12-11-20-5-3-2-4-6-20)28-10-9-24(39-28)18-29-31(36)34(32(40)41-29)27-14-21-7-8-22(27)13-21/h2-6,9-10,15-18,21-22,27H,7-8,11-14,19H2,1H3,(H,33,35)/b29-18- |
| InChIKey | UKXBBTLDAMKHOK-MIXAMLLLSA-N |
| XLogP | 6.08 |
| TPSA | 81.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 588.75 |
| LogP ≤ 5 | 6.08 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|