C32H30N2O6S2 — CID 88875208
(2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-3-phenylpropanoic acid (PubChem CID 88875208) has the molecular formula C32H30N2O6S2 and a molecular weight of 602.73 g/mol. Its IUPAC name is (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-3-phenylpropanoic acid.
| Compound Name | (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-3-phenylpropanoic acid |
|---|---|
| PubChem CID | 88875208 |
| Molecular Formula | C32H30N2O6S2 |
| Molecular Weight | 602.73 g/mol |
| Exact Mass | 602.15 |
| IUPAC Name | (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-3-phenylpropanoic acid |
| SMILES | COc1ccc(-c2ccc(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)cc1C(=O)N[C@@H](Cc1ccccc1)C(=O)O |
| InChI | InChI=1S/C32H30N2O6S2/c1-39-27-11-9-21(16-23(27)29(35)33-24(31(37)38)14-18-5-3-2-4-6-18)26-12-10-22(40-26)17-28-30(36)34(32(41)42-28)25-15-19-7-8-20(25)13-19/h2-6,9-12,16-17,19-20,24-25H,7-8,13-15H2,1H3,(H,33,35)(H,37,38)/b28-17-/t19?,20?,24-,25?/m0/s1 |
| InChIKey | QVFFUGAVKSXXEN-MIBYXKCASA-N |
| XLogP | 5.77 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 602.73 |
| LogP ≤ 5 | 5.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|