C28H29NO6S2 — CID 123701451
methyl 5-[5-[[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2,3-dimethoxybenzoate (PubChem CID 123701451) has the molecular formula C28H29NO6S2 and a molecular weight of 539.68 g/mol. Its IUPAC name is methyl 5-[5-[[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2,3-dimethoxybenzoate.
| Compound Name | methyl 5-[5-[[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2,3-dimethoxybenzoate |
|---|---|
| PubChem CID | 123701451 |
| Molecular Formula | C28H29NO6S2 |
| Molecular Weight | 539.68 g/mol |
| Exact Mass | 539.14 |
| IUPAC Name | methyl 5-[5-[[3-(2-adamantyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2,3-dimethoxybenzoate |
| SMILES | COC(=O)c1cc(-c2ccc(C=C3SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)o2)cc(OC)c1OC |
| InChI | InChI=1S/C28H29NO6S2/c1-32-22-12-16(11-20(25(22)33-2)27(31)34-3)21-5-4-19(35-21)13-23-26(30)29(28(36)37-23)24-17-7-14-6-15(9-17)10-18(24)8-14/h4-5,11-15,17-18,24H,6-10H2,1-3H3 |
| InChIKey | GIEGKWZQPKTVBD-UHFFFAOYSA-N |
| XLogP | 5.78 |
| TPSA | 78.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.68 |
| LogP ≤ 5 | 5.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|