C26H26N2O6S2 — CID 88875696
(2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]propanoic acid (PubChem CID 88875696) has the molecular formula C26H26N2O6S2 and a molecular weight of 526.64 g/mol. Its IUPAC name is (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]propanoic acid.
| Compound Name | (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]propanoic acid |
|---|---|
| PubChem CID | 88875696 |
| Molecular Formula | C26H26N2O6S2 |
| Molecular Weight | 526.64 g/mol |
| Exact Mass | 526.12 |
| IUPAC Name | (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]propanoic acid |
| SMILES | COc1ccc(-c2ccc(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)cc1C(=O)N[C@@H](C)C(=O)O |
| InChI | InChI=1S/C26H26N2O6S2/c1-13(25(31)32)27-23(29)18-11-16(5-7-21(18)33-2)20-8-6-17(34-20)12-22-24(30)28(26(35)36-22)19-10-14-3-4-15(19)9-14/h5-8,11-15,19H,3-4,9-10H2,1-2H3,(H,27,29)(H,31,32)/b22-12-/t13-,14?,15?,19?/m0/s1 |
| InChIKey | RCGYNISJRIGJBB-SUQSVBBUSA-N |
| XLogP | 4.55 |
| TPSA | 109.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.64 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|