C28H28N2O8S2 — CID 89485316
(2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-4-methoxy-4-oxobutanoic acid (PubChem CID 89485316) has the molecular formula C28H28N2O8S2 and a molecular weight of 584.67 g/mol. Its IUPAC name is (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-4-methoxy-4-oxobutanoic acid.
| Compound Name | (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-4-methoxy-4-oxobutanoic acid |
|---|---|
| PubChem CID | 89485316 |
| Molecular Formula | C28H28N2O8S2 |
| Molecular Weight | 584.67 g/mol |
| Exact Mass | 584.13 |
| IUPAC Name | (2S)-2-[[5-[5-[(Z)-[3-(2-bicyclo[2.2.1]heptanyl)-4-oxo-2-sulfanylidene-1,3-thiazolidin-5-ylidene]methyl]furan-2-yl]-2-methoxybenzoyl]amino]-4-methoxy-4-oxobutanoic acid |
| SMILES | COC(=O)C[C@H](NC(=O)c1cc(-c2ccc(/C=C3\SC(=S)N(C4CC5CCC4C5)C3=O)o2)ccc1OC)C(=O)O |
| InChI | InChI=1S/C28H28N2O8S2/c1-36-22-7-5-16(11-18(22)25(32)29-19(27(34)35)13-24(31)37-2)21-8-6-17(38-21)12-23-26(33)30(28(39)40-23)20-10-14-3-4-15(20)9-14/h5-8,11-12,14-15,19-20H,3-4,9-10,13H2,1-2H3,(H,29,32)(H,34,35)/b23-12-/t14?,15?,19-,20?/m0/s1 |
| InChIKey | HTJNSESHUXAFDO-YDNOYJBESA-N |
| XLogP | 4.09 |
| TPSA | 135.38 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 40 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 584.67 |
| LogP ≤ 5 | 4.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 9 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|