C28H32N2O4S2 — CID 89485115
(5Z)-3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3-hydroxy-5-methoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 89485115) has the molecular formula C28H32N2O4S2 and a molecular weight of 524.71 g/mol. Its IUPAC name is (5Z)-3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3-hydroxy-5-methoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | (5Z)-3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3-hydroxy-5-methoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 89485115 |
| Molecular Formula | C28H32N2O4S2 |
| Molecular Weight | 524.71 g/mol |
| Exact Mass | 524.18 |
| IUPAC Name | (5Z)-3-(2-adamantyl)-5-[[3-(3-aminopropyl)-5-(3-hydroxy-5-methoxyphenyl)furan-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cc(O)cc(-c2cc(CCCN)c(/C=C3\SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)o2)c1 |
| InChI | InChI=1S/C28H32N2O4S2/c1-33-22-11-18(10-21(31)13-22)23-12-17(3-2-4-29)24(34-23)14-25-27(32)30(28(35)36-25)26-19-6-15-5-16(8-19)9-20(26)7-15/h10-16,19-20,26,31H,2-9,29H2,1H3/b25-14- |
| InChIKey | RAAPPWOQNWWCCC-QFEZKATASA-N |
| XLogP | 5.58 |
| TPSA | 88.93 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 524.71 |
| LogP ≤ 5 | 5.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|