C30H36N2O3S2 — CID 123670860
3-(2-adamantyl)-5-[[3-(5-hydroxypentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one (PubChem CID 123670860) has the molecular formula C30H36N2O3S2 and a molecular weight of 536.76 g/mol. Its IUPAC name is 3-(2-adamantyl)-5-[[3-(5-hydroxypentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one.
| Compound Name | 3-(2-adamantyl)-5-[[3-(5-hydroxypentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
|---|---|
| PubChem CID | 123670860 |
| Molecular Formula | C30H36N2O3S2 |
| Molecular Weight | 536.76 g/mol |
| Exact Mass | 536.22 |
| IUPAC Name | 3-(2-adamantyl)-5-[[3-(5-hydroxypentyl)-5-(3-methoxyphenyl)-1H-pyrrol-2-yl]methylidene]-2-sulfanylidene-1,3-thiazolidin-4-one |
| SMILES | COc1cccc(-c2cc(CCCCCO)c(C=C3SC(=S)N(C4C5CC6CC(C5)CC4C6)C3=O)[nH]2)c1 |
| InChI | InChI=1S/C30H36N2O3S2/c1-35-24-8-5-7-20(15-24)25-16-21(6-3-2-4-9-33)26(31-25)17-27-29(34)32(30(36)37-27)28-22-11-18-10-19(13-22)14-23(28)12-18/h5,7-8,15-19,22-23,28,31,33H,2-4,6,9-14H2,1H3 |
| InChIKey | RUSMCFAODRTHHC-UHFFFAOYSA-N |
| XLogP | 6.42 |
| TPSA | 65.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 37 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 536.76 |
| LogP ≤ 5 | 6.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ene_rhod_A(235)', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|