C18H28N2 — CID 89492811
5-tert-butyl-2-[(E)-3-(4-methylpiperidin-1-yl)prop-1-enyl]pyridine (PubChem CID 89492811) has the molecular formula C18H28N2 and a molecular weight of 272.44 g/mol. Its IUPAC name is 5-tert-butyl-2-[(E)-3-(4-methylpiperidin-1-yl)prop-1-enyl]pyridine.
| Compound Name | 5-tert-butyl-2-[(E)-3-(4-methylpiperidin-1-yl)prop-1-enyl]pyridine |
|---|---|
| PubChem CID | 89492811 |
| Molecular Formula | C18H28N2 |
| Molecular Weight | 272.44 g/mol |
| Exact Mass | 272.23 |
| IUPAC Name | 5-tert-butyl-2-[(E)-3-(4-methylpiperidin-1-yl)prop-1-enyl]pyridine |
| SMILES | CC1CCN(C/C=C/c2ccc(C(C)(C)C)cn2)CC1 |
| InChI | InChI=1S/C18H28N2/c1-15-9-12-20(13-10-15)11-5-6-17-8-7-16(14-19-17)18(2,3)4/h5-8,14-15H,9-13H2,1-4H3/b6-5+ |
| InChIKey | SKUNJMSQZCBBDE-AATRIKPKSA-N |
| XLogP | 4.12 |
| TPSA | 16.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 272.44 |
| LogP ≤ 5 | 4.12 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |