C15H13ClN2O2 — CID 89493907
2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde (PubChem CID 89493907) has the molecular formula C15H13ClN2O2 and a molecular weight of 288.73 g/mol. Its IUPAC name is 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde.
| Compound Name | 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde |
|---|---|
| PubChem CID | 89493907 |
| Molecular Formula | C15H13ClN2O2 |
| Molecular Weight | 288.73 g/mol |
| Exact Mass | 288.07 |
| IUPAC Name | 2-[7-(3-chlorophenyl)-1-oxo-3,4-dihydro-2H-pyrrolo[1,2-a]pyrazin-4-yl]acetaldehyde |
| SMILES | O=CCC1CNC(=O)c2cc(-c3cccc(Cl)c3)cn21 |
| InChI | InChI=1S/C15H13ClN2O2/c16-12-3-1-2-10(6-12)11-7-14-15(20)17-8-13(4-5-19)18(14)9-11/h1-3,5-7,9,13H,4,8H2,(H,17,20) |
| InChIKey | COQHDSDCOIAKHH-UHFFFAOYSA-N |
| XLogP | 2.68 |
| TPSA | 51.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.73 |
| LogP ≤ 5 | 2.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|