C18H18BrN5O — CID 89494171
[3-(5-bromoimidazo[4,5-b]pyridin-3-yl)phenyl]-(4-methylpiperazin-1-yl)methanone (PubChem CID 89494171) has the molecular formula C18H18BrN5O and a molecular weight of 400.28 g/mol. Its IUPAC name is [3-(5-bromoimidazo[4,5-b]pyridin-3-yl)phenyl]-(4-methylpiperazin-1-yl)methanone.
| Compound Name | [3-(5-bromoimidazo[4,5-b]pyridin-3-yl)phenyl]-(4-methylpiperazin-1-yl)methanone |
|---|---|
| PubChem CID | 89494171 |
| Molecular Formula | C18H18BrN5O |
| Molecular Weight | 400.28 g/mol |
| Exact Mass | 399.07 |
| IUPAC Name | [3-(5-bromoimidazo[4,5-b]pyridin-3-yl)phenyl]-(4-methylpiperazin-1-yl)methanone |
| SMILES | CN1CCN(C(=O)c2cccc(-n3cnc4ccc(Br)nc43)c2)CC1 |
| InChI | InChI=1S/C18H18BrN5O/c1-22-7-9-23(10-8-22)18(25)13-3-2-4-14(11-13)24-12-20-15-5-6-16(19)21-17(15)24/h2-6,11-12H,7-10H2,1H3 |
| InChIKey | XQFXKQDDUFVZIU-UHFFFAOYSA-N |
| XLogP | 2.57 |
| TPSA | 54.26 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 400.28 |
| LogP ≤ 5 | 2.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|