C18H17F3O4 — CID 89496872
2-(2,5-dimethoxyphenyl)-2-[3-methoxy-4-(trifluoromethyl)phenyl]acetaldehyde (PubChem CID 89496872) has the molecular formula C18H17F3O4 and a molecular weight of 354.32 g/mol. Its IUPAC name is 2-(2,5-dimethoxyphenyl)-2-[3-methoxy-4-(trifluoromethyl)phenyl]acetaldehyde.
| Compound Name | 2-(2,5-dimethoxyphenyl)-2-[3-methoxy-4-(trifluoromethyl)phenyl]acetaldehyde |
|---|---|
| PubChem CID | 89496872 |
| Molecular Formula | C18H17F3O4 |
| Molecular Weight | 354.32 g/mol |
| Exact Mass | 354.11 |
| IUPAC Name | 2-(2,5-dimethoxyphenyl)-2-[3-methoxy-4-(trifluoromethyl)phenyl]acetaldehyde |
| SMILES | COc1ccc(OC)c(C(C=O)c2ccc(C(F)(F)F)c(OC)c2)c1 |
| InChI | InChI=1S/C18H17F3O4/c1-23-12-5-7-16(24-2)13(9-12)14(10-22)11-4-6-15(18(19,20)21)17(8-11)25-3/h4-10,14H,1-3H3 |
| InChIKey | MNFOIDVYKFADGP-UHFFFAOYSA-N |
| XLogP | 4.06 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 354.32 |
| LogP ≤ 5 | 4.06 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|