C16H15ClO3 — CID 89497006
2-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)acetaldehyde (PubChem CID 89497006) has the molecular formula C16H15ClO3 and a molecular weight of 290.75 g/mol. Its IUPAC name is 2-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)acetaldehyde.
| Compound Name | 2-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)acetaldehyde |
|---|---|
| PubChem CID | 89497006 |
| Molecular Formula | C16H15ClO3 |
| Molecular Weight | 290.75 g/mol |
| Exact Mass | 290.07 |
| IUPAC Name | 2-(4-chlorophenyl)-2-(2,5-dimethoxyphenyl)acetaldehyde |
| SMILES | COc1ccc(OC)c(C(C=O)c2ccc(Cl)cc2)c1 |
| InChI | InChI=1S/C16H15ClO3/c1-19-13-7-8-16(20-2)14(9-13)15(10-18)11-3-5-12(17)6-4-11/h3-10,15H,1-2H3 |
| InChIKey | IVKFBBQYAMLAOH-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.75 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|