C23H25N3O2 — CID 89497610
tert-butyl (2S)-4-cyclopropyl-2-[5-(4-ethynylphenyl)-1H-imidazol-2-yl]-2,5-dihydropyrrole-1-carboxylate (PubChem CID 89497610) has the molecular formula C23H25N3O2 and a molecular weight of 375.47 g/mol. Its IUPAC name is tert-butyl (2S)-4-cyclopropyl-2-[5-(4-ethynylphenyl)-1H-imidazol-2-yl]-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-4-cyclopropyl-2-[5-(4-ethynylphenyl)-1H-imidazol-2-yl]-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 89497610 |
| Molecular Formula | C23H25N3O2 |
| Molecular Weight | 375.47 g/mol |
| Exact Mass | 375.19 |
| IUPAC Name | tert-butyl (2S)-4-cyclopropyl-2-[5-(4-ethynylphenyl)-1H-imidazol-2-yl]-2,5-dihydropyrrole-1-carboxylate |
| SMILES | C#Cc1ccc(-c2cnc([C@@H]3C=C(C4CC4)CN3C(=O)OC(C)(C)C)[nH]2)cc1 |
| InChI | InChI=1S/C23H25N3O2/c1-5-15-6-8-17(9-7-15)19-13-24-21(25-19)20-12-18(16-10-11-16)14-26(20)22(27)28-23(2,3)4/h1,6-9,12-13,16,20H,10-11,14H2,2-4H3,(H,24,25)/t20-/m0/s1 |
| InChIKey | MMKBIQKUBCYTMK-FQEVSTJZSA-N |
| XLogP | 4.69 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 375.47 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|