C25H25N3O2 — CID 89497623
tert-butyl (2S)-2-[5-(6-ethynylnaphthalen-2-yl)-1H-imidazol-2-yl]-4-methyl-2,5-dihydropyrrole-1-carboxylate (PubChem CID 89497623) has the molecular formula C25H25N3O2 and a molecular weight of 399.49 g/mol. Its IUPAC name is tert-butyl (2S)-2-[5-(6-ethynylnaphthalen-2-yl)-1H-imidazol-2-yl]-4-methyl-2,5-dihydropyrrole-1-carboxylate.
| Compound Name | tert-butyl (2S)-2-[5-(6-ethynylnaphthalen-2-yl)-1H-imidazol-2-yl]-4-methyl-2,5-dihydropyrrole-1-carboxylate |
|---|---|
| PubChem CID | 89497623 |
| Molecular Formula | C25H25N3O2 |
| Molecular Weight | 399.49 g/mol |
| Exact Mass | 399.19 |
| IUPAC Name | tert-butyl (2S)-2-[5-(6-ethynylnaphthalen-2-yl)-1H-imidazol-2-yl]-4-methyl-2,5-dihydropyrrole-1-carboxylate |
| SMILES | C#Cc1ccc2cc(-c3cnc([C@@H]4C=C(C)CN4C(=O)OC(C)(C)C)[nH]3)ccc2c1 |
| InChI | InChI=1S/C25H25N3O2/c1-6-17-7-8-19-13-20(10-9-18(19)12-17)21-14-26-23(27-21)22-11-16(2)15-28(22)24(29)30-25(3,4)5/h1,7-14,22H,15H2,2-5H3,(H,26,27)/t22-/m0/s1 |
| InChIKey | IROBBXJZVYYKCO-QFIPXVFZSA-N |
| XLogP | 5.45 |
| TPSA | 58.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 399.49 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|