C24H25NO4S — CID 8956999
[2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate (PubChem CID 8956999) has the molecular formula C24H25NO4S and a molecular weight of 423.53 g/mol. Its IUPAC name is [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate.
| Compound Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate |
|---|---|
| PubChem CID | 8956999 |
| Molecular Formula | C24H25NO4S |
| Molecular Weight | 423.53 g/mol |
| Exact Mass | 423.15 |
| IUPAC Name | [2-oxo-2-(2-thiophen-2-ylethylamino)ethyl] 2-ethoxy-2,2-diphenylacetate |
| SMILES | CCOC(C(=O)OCC(=O)NCCc1cccs1)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H25NO4S/c1-2-29-24(19-10-5-3-6-11-19,20-12-7-4-8-13-20)23(27)28-18-22(26)25-16-15-21-14-9-17-30-21/h3-14,17H,2,15-16,18H2,1H3,(H,25,26) |
| InChIKey | SYSZXAPZGNGHML-UHFFFAOYSA-N |
| XLogP | 3.93 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.53 |
| LogP ≤ 5 | 3.93 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |