C19H22N3O3+ — CID 8962494
N-[4-(4-methylphenoxy)phenyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 8962494) has the molecular formula C19H22N3O3+ and a molecular weight of 340.40 g/mol. Its IUPAC name is N-[4-(4-methylphenoxy)phenyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-[4-(4-methylphenoxy)phenyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8962494 |
| Molecular Formula | C19H22N3O3+ |
| Molecular Weight | 340.40 g/mol |
| Exact Mass | 340.17 |
| IUPAC Name | N-[4-(4-methylphenoxy)phenyl]-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1ccc(Oc2ccc(NC(=O)C[NH+]3CCNC(=O)C3)cc2)cc1 |
| InChI | InChI=1S/C19H21N3O3/c1-14-2-6-16(7-3-14)25-17-8-4-15(5-9-17)21-19(24)13-22-11-10-20-18(23)12-22/h2-9H,10-13H2,1H3,(H,20,23)(H,21,24)/p+1 |
| InChIKey | WMYKLUQMQYGPLI-UHFFFAOYSA-O |
| XLogP | 0.74 |
| TPSA | 71.87 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.40 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |