C12H15IN3O2+ — CID 2657029
N-(2-iodophenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 2657029) has the molecular formula C12H15IN3O2+ and a molecular weight of 360.18 g/mol. Its IUPAC name is N-(2-iodophenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(2-iodophenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 2657029 |
| Molecular Formula | C12H15IN3O2+ |
| Molecular Weight | 360.18 g/mol |
| Exact Mass | 360.02 |
| IUPAC Name | N-(2-iodophenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | O=C1C[NH+](CC(=O)Nc2ccccc2I)CCN1 |
| InChI | InChI=1S/C12H14IN3O2/c13-9-3-1-2-4-10(9)15-12(18)8-16-6-5-14-11(17)7-16/h1-4H,5-8H2,(H,14,17)(H,15,18)/p+1 |
| InChIKey | MTDGFFZYZVLZTG-UHFFFAOYSA-O |
| XLogP | -0.76 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.18 |
| LogP ≤ 5 | -0.76 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|