C13H17ClN3O2+ — CID 8963304
N-(4-chloro-2-methylphenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide (PubChem CID 8963304) has the molecular formula C13H17ClN3O2+ and a molecular weight of 282.75 g/mol. Its IUPAC name is N-(4-chloro-2-methylphenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide.
| Compound Name | N-(4-chloro-2-methylphenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
|---|---|
| PubChem CID | 8963304 |
| Molecular Formula | C13H17ClN3O2+ |
| Molecular Weight | 282.75 g/mol |
| Exact Mass | 282.10 |
| IUPAC Name | N-(4-chloro-2-methylphenyl)-2-(3-oxopiperazin-1-ium-1-yl)acetamide |
| SMILES | Cc1cc(Cl)ccc1NC(=O)C[NH+]1CCNC(=O)C1 |
| InChI | InChI=1S/C13H16ClN3O2/c1-9-6-10(14)2-3-11(9)16-13(19)8-17-5-4-15-12(18)7-17/h2-3,6H,4-5,7-8H2,1H3,(H,15,18)(H,16,19)/p+1 |
| InChIKey | PQNHPBPEXRRJGZ-UHFFFAOYSA-O |
| XLogP | -0.40 |
| TPSA | 62.64 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 282.75 |
| LogP ≤ 5 | -0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 2 |