C20H23N4O3+ — CID 8549550
N-(3-methylphenyl)-2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]benzamide (PubChem CID 8549550) has the molecular formula C20H23N4O3+ and a molecular weight of 367.43 g/mol. Its IUPAC name is N-(3-methylphenyl)-2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]benzamide.
| Compound Name | N-(3-methylphenyl)-2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]benzamide |
|---|---|
| PubChem CID | 8549550 |
| Molecular Formula | C20H23N4O3+ |
| Molecular Weight | 367.43 g/mol |
| Exact Mass | 367.18 |
| IUPAC Name | N-(3-methylphenyl)-2-[[2-(3-oxopiperazin-1-ium-1-yl)acetyl]amino]benzamide |
| SMILES | Cc1cccc(NC(=O)c2ccccc2NC(=O)C[NH+]2CCNC(=O)C2)c1 |
| InChI | InChI=1S/C20H22N4O3/c1-14-5-4-6-15(11-14)22-20(27)16-7-2-3-8-17(16)23-19(26)13-24-10-9-21-18(25)12-24/h2-8,11H,9-10,12-13H2,1H3,(H,21,25)(H,22,27)(H,23,26)/p+1 |
| InChIKey | MVKGZUYGXVOILQ-UHFFFAOYSA-O |
| XLogP | 0.20 |
| TPSA | 91.74 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 367.43 |
| LogP ≤ 5 | 0.20 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 3 |