C19H20N2OS — CID 8965050
4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(2-methoxyphenyl)-1,3-thiazole (PubChem CID 8965050) has the molecular formula C19H20N2OS and a molecular weight of 324.45 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(2-methoxyphenyl)-1,3-thiazole.
| Compound Name | 4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(2-methoxyphenyl)-1,3-thiazole |
|---|---|
| PubChem CID | 8965050 |
| Molecular Formula | C19H20N2OS |
| Molecular Weight | 324.45 g/mol |
| Exact Mass | 324.13 |
| IUPAC Name | 4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-2-(2-methoxyphenyl)-1,3-thiazole |
| SMILES | C=CCn1c(C)cc(-c2csc(-c3ccccc3OC)n2)c1C |
| InChI | InChI=1S/C19H20N2OS/c1-5-10-21-13(2)11-16(14(21)3)17-12-23-19(20-17)15-8-6-7-9-18(15)22-4/h5-9,11-12H,1,10H2,2-4H3 |
| InChIKey | OSZCBZNNZKKAKZ-UHFFFAOYSA-N |
| XLogP | 5.09 |
| TPSA | 27.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 324.45 |
| LogP ≤ 5 | 5.09 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|