C17H19ClN4S — CID 126797870
4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride (PubChem CID 126797870) has the molecular formula C17H19ClN4S and a molecular weight of 346.89 g/mol. Its IUPAC name is 4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride.
| Compound Name | 4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride |
|---|---|
| PubChem CID | 126797870 |
| Molecular Formula | C17H19ClN4S |
| Molecular Weight | 346.89 g/mol |
| Exact Mass | 346.10 |
| IUPAC Name | 4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-N-pyridin-2-yl-1,3-thiazol-2-amine;hydrochloride |
| SMILES | C=CCn1c(C)cc(-c2csc(Nc3ccccn3)n2)c1C.Cl |
| InChI | InChI=1S/C17H18N4S.ClH/c1-4-9-21-12(2)10-14(13(21)3)15-11-22-17(19-15)20-16-7-5-6-8-18-16;/h4-8,10-11H,1,9H2,2-3H3,(H,18,19,20);1H |
| InChIKey | BJELKXUZXKPXDL-UHFFFAOYSA-N |
| XLogP | 4.97 |
| TPSA | 42.74 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.89 |
| LogP ≤ 5 | 4.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|