C20H22N4OS — CID 17455131
N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylpropanamide (PubChem CID 17455131) has the molecular formula C20H22N4OS and a molecular weight of 366.49 g/mol. Its IUPAC name is N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylpropanamide.
| Compound Name | N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylpropanamide |
|---|---|
| PubChem CID | 17455131 |
| Molecular Formula | C20H22N4OS |
| Molecular Weight | 366.49 g/mol |
| Exact Mass | 366.15 |
| IUPAC Name | N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-3-pyridin-3-ylpropanamide |
| SMILES | C=CCn1c(C)cc(-c2csc(NC(=O)CCc3cccnc3)n2)c1C |
| InChI | InChI=1S/C20H22N4OS/c1-4-10-24-14(2)11-17(15(24)3)18-13-26-20(22-18)23-19(25)8-7-16-6-5-9-21-12-16/h4-6,9,11-13H,1,7-8,10H2,2-3H3,(H,22,23,25) |
| InChIKey | ILUKTACLLYYWJB-UHFFFAOYSA-N |
| XLogP | 4.38 |
| TPSA | 59.81 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.49 |
| LogP ≤ 5 | 4.38 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|