C21H22N4O3S — CID 17466318
4-(2-amino-2-oxoethoxy)-N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]benzamide (PubChem CID 17466318) has the molecular formula C21H22N4O3S and a molecular weight of 410.50 g/mol. Its IUPAC name is 4-(2-amino-2-oxoethoxy)-N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]benzamide.
| Compound Name | 4-(2-amino-2-oxoethoxy)-N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]benzamide |
|---|---|
| PubChem CID | 17466318 |
| Molecular Formula | C21H22N4O3S |
| Molecular Weight | 410.50 g/mol |
| Exact Mass | 410.14 |
| IUPAC Name | 4-(2-amino-2-oxoethoxy)-N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]benzamide |
| SMILES | C=CCn1c(C)cc(-c2csc(NC(=O)c3ccc(OCC(N)=O)cc3)n2)c1C |
| InChI | InChI=1S/C21H22N4O3S/c1-4-9-25-13(2)10-17(14(25)3)18-12-29-21(23-18)24-20(27)15-5-7-16(8-6-15)28-11-19(22)26/h4-8,10,12H,1,9,11H2,2-3H3,(H2,22,26)(H,23,24,27) |
| InChIKey | KWDQPGYMIRZCOE-UHFFFAOYSA-N |
| XLogP | 3.53 |
| TPSA | 99.24 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 410.50 |
| LogP ≤ 5 | 3.53 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|