C21H26N4O3S3 — CID 24595488
N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide (PubChem CID 24595488) has the molecular formula C21H26N4O3S3 and a molecular weight of 478.67 g/mol. Its IUPAC name is N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide.
| Compound Name | N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
|---|---|
| PubChem CID | 24595488 |
| Molecular Formula | C21H26N4O3S3 |
| Molecular Weight | 478.67 g/mol |
| Exact Mass | 478.12 |
| IUPAC Name | N-[4-(2,5-dimethyl-1-prop-2-enylpyrrol-3-yl)-1,3-thiazol-2-yl]-4-[methyl(thiophen-2-ylsulfonyl)amino]butanamide |
| SMILES | C=CCn1c(C)cc(-c2csc(NC(=O)CCCN(C)S(=O)(=O)c3cccs3)n2)c1C |
| InChI | InChI=1S/C21H26N4O3S3/c1-5-10-25-15(2)13-17(16(25)3)18-14-30-21(22-18)23-19(26)8-6-11-24(4)31(27,28)20-9-7-12-29-20/h5,7,9,12-14H,1,6,8,10-11H2,2-4H3,(H,22,23,26) |
| InChIKey | GRLBZTYWMKGMKB-UHFFFAOYSA-N |
| XLogP | 4.52 |
| TPSA | 84.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 478.67 |
| LogP ≤ 5 | 4.52 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|