C15H18N3O2S- — CID 51645903
3-[2,5-dimethyl-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrrol-1-yl]propanoate (PubChem CID 51645903) has the molecular formula C15H18N3O2S- and a molecular weight of 304.40 g/mol. Its IUPAC name is 3-[2,5-dimethyl-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrrol-1-yl]propanoate.
| Compound Name | 3-[2,5-dimethyl-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 51645903 |
| Molecular Formula | C15H18N3O2S- |
| Molecular Weight | 304.40 g/mol |
| Exact Mass | 304.11 |
| IUPAC Name | 3-[2,5-dimethyl-3-[2-(prop-2-enylamino)-1,3-thiazol-4-yl]pyrrol-1-yl]propanoate |
| SMILES | C=CCNc1nc(-c2cc(C)n(CCC(=O)[O-])c2C)cs1 |
| InChI | InChI=1S/C15H19N3O2S/c1-4-6-16-15-17-13(9-21-15)12-8-10(2)18(11(12)3)7-5-14(19)20/h4,8-9H,1,5-7H2,2-3H3,(H,16,17)(H,19,20)/p-1 |
| InChIKey | FCQLPCFKHJQFSV-UHFFFAOYSA-M |
| XLogP | 1.97 |
| TPSA | 69.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 304.40 |
| LogP ≤ 5 | 1.97 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|