C20H19N3O3S — CID 8965360
methyl 3-[3-[2-[(E)-1-cyano-2-(furan-2-yl)ethenyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]propanoate (PubChem CID 8965360) has the molecular formula C20H19N3O3S and a molecular weight of 381.46 g/mol. Its IUPAC name is methyl 3-[3-[2-[(E)-1-cyano-2-(furan-2-yl)ethenyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]propanoate.
| Compound Name | methyl 3-[3-[2-[(E)-1-cyano-2-(furan-2-yl)ethenyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]propanoate |
|---|---|
| PubChem CID | 8965360 |
| Molecular Formula | C20H19N3O3S |
| Molecular Weight | 381.46 g/mol |
| Exact Mass | 381.11 |
| IUPAC Name | methyl 3-[3-[2-[(E)-1-cyano-2-(furan-2-yl)ethenyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]propanoate |
| SMILES | COC(=O)CCn1c(C)cc(-c2csc(/C(C#N)=C/c3ccco3)n2)c1C |
| InChI | InChI=1S/C20H19N3O3S/c1-13-9-17(14(2)23(13)7-6-19(24)25-3)18-12-27-20(22-18)15(11-21)10-16-5-4-8-26-16/h4-5,8-10,12H,6-7H2,1-3H3/b15-10+ |
| InChIKey | GPHJNJLHPZQIBE-XNTDXEJSSA-N |
| XLogP | 4.45 |
| TPSA | 81.05 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 381.46 |
| LogP ≤ 5 | 4.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|