C21H25N3O2S — CID 9356519
methyl 4-[3-[2-[cyano(cyclopentylidene)methyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]butanoate (PubChem CID 9356519) has the molecular formula C21H25N3O2S and a molecular weight of 383.52 g/mol. Its IUPAC name is methyl 4-[3-[2-[cyano(cyclopentylidene)methyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]butanoate.
| Compound Name | methyl 4-[3-[2-[cyano(cyclopentylidene)methyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]butanoate |
|---|---|
| PubChem CID | 9356519 |
| Molecular Formula | C21H25N3O2S |
| Molecular Weight | 383.52 g/mol |
| Exact Mass | 383.17 |
| IUPAC Name | methyl 4-[3-[2-[cyano(cyclopentylidene)methyl]-1,3-thiazol-4-yl]-2,5-dimethylpyrrol-1-yl]butanoate |
| SMILES | COC(=O)CCCn1c(C)cc(-c2csc(C(C#N)=C3CCCC3)n2)c1C |
| InChI | InChI=1S/C21H25N3O2S/c1-14-11-17(15(2)24(14)10-6-9-20(25)26-3)19-13-27-21(23-19)18(12-22)16-7-4-5-8-16/h11,13H,4-10H2,1-3H3 |
| InChIKey | LGNKVVAZMMFYRN-UHFFFAOYSA-N |
| XLogP | 5.03 |
| TPSA | 67.91 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 383.52 |
| LogP ≤ 5 | 5.03 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|