C18H21N3S — CID 9356483
2-cyclopentylidene-2-[4-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 9356483) has the molecular formula C18H21N3S and a molecular weight of 311.45 g/mol. Its IUPAC name is 2-cyclopentylidene-2-[4-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-cyclopentylidene-2-[4-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 9356483 |
| Molecular Formula | C18H21N3S |
| Molecular Weight | 311.45 g/mol |
| Exact Mass | 311.15 |
| IUPAC Name | 2-cyclopentylidene-2-[4-(1-ethyl-2,5-dimethylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | CCn1c(C)cc(-c2csc(C(C#N)=C3CCCC3)n2)c1C |
| InChI | InChI=1S/C18H21N3S/c1-4-21-12(2)9-15(13(21)3)17-11-22-18(20-17)16(10-19)14-7-5-6-8-14/h9,11H,4-8H2,1-3H3 |
| InChIKey | AATKXVUDLRBJCE-UHFFFAOYSA-N |
| XLogP | 5.10 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 22 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.45 |
| LogP ≤ 5 | 5.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|