C19H18F2N2O2S — CID 9344174
2-cyclohexylidene-2-[4-[4-(difluoromethoxy)-3-methoxyphenyl]-1,3-thiazol-2-yl]acetonitrile (PubChem CID 9344174) has the molecular formula C19H18F2N2O2S and a molecular weight of 376.43 g/mol. Its IUPAC name is 2-cyclohexylidene-2-[4-[4-(difluoromethoxy)-3-methoxyphenyl]-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-cyclohexylidene-2-[4-[4-(difluoromethoxy)-3-methoxyphenyl]-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 9344174 |
| Molecular Formula | C19H18F2N2O2S |
| Molecular Weight | 376.43 g/mol |
| Exact Mass | 376.11 |
| IUPAC Name | 2-cyclohexylidene-2-[4-[4-(difluoromethoxy)-3-methoxyphenyl]-1,3-thiazol-2-yl]acetonitrile |
| SMILES | COc1cc(-c2csc(C(C#N)=C3CCCCC3)n2)ccc1OC(F)F |
| InChI | InChI=1S/C19H18F2N2O2S/c1-24-17-9-13(7-8-16(17)25-19(20)21)15-11-26-18(23-15)14(10-22)12-5-3-2-4-6-12/h7-9,11,19H,2-6H2,1H3 |
| InChIKey | PQBFMSDIYZIZGV-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 55.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.43 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|