C19H23N3S — CID 9356485
2-cyclopentylidene-2-[4-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile (PubChem CID 9356485) has the molecular formula C19H23N3S and a molecular weight of 325.48 g/mol. Its IUPAC name is 2-cyclopentylidene-2-[4-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile.
| Compound Name | 2-cyclopentylidene-2-[4-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile |
|---|---|
| PubChem CID | 9356485 |
| Molecular Formula | C19H23N3S |
| Molecular Weight | 325.48 g/mol |
| Exact Mass | 325.16 |
| IUPAC Name | 2-cyclopentylidene-2-[4-(2,5-dimethyl-1-propan-2-ylpyrrol-3-yl)-1,3-thiazol-2-yl]acetonitrile |
| SMILES | Cc1cc(-c2csc(C(C#N)=C3CCCC3)n2)c(C)n1C(C)C |
| InChI | InChI=1S/C19H23N3S/c1-12(2)22-13(3)9-16(14(22)4)18-11-23-19(21-18)17(10-20)15-7-5-6-8-15/h9,11-12H,5-8H2,1-4H3 |
| InChIKey | LMWMQIBGXJLRMI-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 41.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 325.48 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|