C19H13N3O2S — CID 9344140
(E)-3-(furan-2-yl)-2-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]prop-2-enenitrile (PubChem CID 9344140) has the molecular formula C19H13N3O2S and a molecular weight of 347.40 g/mol. Its IUPAC name is (E)-3-(furan-2-yl)-2-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]prop-2-enenitrile.
| Compound Name | (E)-3-(furan-2-yl)-2-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
|---|---|
| PubChem CID | 9344140 |
| Molecular Formula | C19H13N3O2S |
| Molecular Weight | 347.40 g/mol |
| Exact Mass | 347.07 |
| IUPAC Name | (E)-3-(furan-2-yl)-2-[4-(2-oxo-3,4-dihydro-1H-quinolin-6-yl)-1,3-thiazol-2-yl]prop-2-enenitrile |
| SMILES | N#C/C(=C\c1ccco1)c1nc(-c2ccc3c(c2)CCC(=O)N3)cs1 |
| InChI | InChI=1S/C19H13N3O2S/c20-10-14(9-15-2-1-7-24-15)19-22-17(11-25-19)13-3-5-16-12(8-13)4-6-18(23)21-16/h1-3,5,7-9,11H,4,6H2,(H,21,23)/b14-9+ |
| InChIKey | KSAORBZGPWITLZ-NTEUORMPSA-N |
| XLogP | 4.35 |
| TPSA | 78.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.40 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'conjugated_nitrile_group', 'substructure': 'N/A'} |
|---|