C21H27FN3O3S+ — CID 8966849
2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-propan-2-ylphenyl)acetamide (PubChem CID 8966849) has the molecular formula C21H27FN3O3S+ and a molecular weight of 420.53 g/mol. Its IUPAC name is 2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-propan-2-ylphenyl)acetamide.
| Compound Name | 2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-propan-2-ylphenyl)acetamide |
|---|---|
| PubChem CID | 8966849 |
| Molecular Formula | C21H27FN3O3S+ |
| Molecular Weight | 420.53 g/mol |
| Exact Mass | 420.18 |
| IUPAC Name | 2-[4-(3-fluorophenyl)sulfonylpiperazin-1-ium-1-yl]-N-(2-propan-2-ylphenyl)acetamide |
| SMILES | CC(C)c1ccccc1NC(=O)C[NH+]1CCN(S(=O)(=O)c2cccc(F)c2)CC1 |
| InChI | InChI=1S/C21H26FN3O3S/c1-16(2)19-8-3-4-9-20(19)23-21(26)15-24-10-12-25(13-11-24)29(27,28)18-7-5-6-17(22)14-18/h3-9,14,16H,10-13,15H2,1-2H3,(H,23,26)/p+1 |
| InChIKey | JCUVNVOMBNMRKM-UHFFFAOYSA-O |
| XLogP | 1.48 |
| TPSA | 70.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 420.53 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |