C18H17ClN2OS — CID 8967993
N-[(1S)-1-(3-chlorophenyl)ethyl]-2-[(2-cyanophenyl)methylsulfanyl]acetamide (PubChem CID 8967993) has the molecular formula C18H17ClN2OS and a molecular weight of 344.87 g/mol. Its IUPAC name is N-[(1S)-1-(3-chlorophenyl)ethyl]-2-[(2-cyanophenyl)methylsulfanyl]acetamide.
| Compound Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-[(2-cyanophenyl)methylsulfanyl]acetamide |
|---|---|
| PubChem CID | 8967993 |
| Molecular Formula | C18H17ClN2OS |
| Molecular Weight | 344.87 g/mol |
| Exact Mass | 344.08 |
| IUPAC Name | N-[(1S)-1-(3-chlorophenyl)ethyl]-2-[(2-cyanophenyl)methylsulfanyl]acetamide |
| SMILES | C[C@H](NC(=O)CSCc1ccccc1C#N)c1cccc(Cl)c1 |
| InChI | InChI=1S/C18H17ClN2OS/c1-13(14-7-4-8-17(19)9-14)21-18(22)12-23-11-16-6-3-2-5-15(16)10-20/h2-9,13H,11-12H2,1H3,(H,21,22)/t13-/m0/s1 |
| InChIKey | QWWOZPBHEQYDOO-ZDUSSCGKSA-N |
| XLogP | 4.32 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 344.87 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |