C22H28N3O3S+ — CID 8969591
(2R)-2-(4-nitrophenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide (PubChem CID 8969591) has the molecular formula C22H28N3O3S+ and a molecular weight of 414.55 g/mol. Its IUPAC name is (2R)-2-(4-nitrophenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide.
| Compound Name | (2R)-2-(4-nitrophenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide |
|---|---|
| PubChem CID | 8969591 |
| Molecular Formula | C22H28N3O3S+ |
| Molecular Weight | 414.55 g/mol |
| Exact Mass | 414.18 |
| IUPAC Name | (2R)-2-(4-nitrophenyl)sulfanyl-N-[[2-(piperidin-1-ium-1-ylmethyl)phenyl]methyl]propanamide |
| SMILES | C[C@@H](Sc1ccc([N+](=O)[O-])cc1)C(=O)NCc1ccccc1C[NH+]1CCCCC1 |
| InChI | InChI=1S/C22H27N3O3S/c1-17(29-21-11-9-20(10-12-21)25(27)28)22(26)23-15-18-7-3-4-8-19(18)16-24-13-5-2-6-14-24/h3-4,7-12,17H,2,5-6,13-16H2,1H3,(H,23,26)/p+1/t17-/m1/s1 |
| InChIKey | AAZMWTRWHXEDHO-QGZVFWFLSA-O |
| XLogP | 2.96 |
| TPSA | 76.68 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.55 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'nitro_group', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|