C18H15N5S — CID 8971795
N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-1,3-benzothiazol-2-amine (PubChem CID 8971795) has the molecular formula C18H15N5S and a molecular weight of 333.42 g/mol. Its IUPAC name is N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-1,3-benzothiazol-2-amine.
| Compound Name | N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-1,3-benzothiazol-2-amine |
|---|---|
| PubChem CID | 8971795 |
| Molecular Formula | C18H15N5S |
| Molecular Weight | 333.42 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | N-[(Z)-(1-benzylpyrazol-4-yl)methylideneamino]-1,3-benzothiazol-2-amine |
| SMILES | C(=N\Nc1nc2ccccc2s1)\c1cnn(Cc2ccccc2)c1 |
| InChI | InChI=1S/C18H15N5S/c1-2-6-14(7-3-1)12-23-13-15(11-20-23)10-19-22-18-21-16-8-4-5-9-17(16)24-18/h1-11,13H,12H2,(H,21,22)/b19-10- |
| InChIKey | XSJRWRWGOQNXOF-GRSHGNNSSA-N |
| XLogP | 3.99 |
| TPSA | 55.10 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.42 |
| LogP ≤ 5 | 3.99 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|