C17H19NO4S — CID 897188
propan-2-yl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate (PubChem CID 897188) has the molecular formula C17H19NO4S and a molecular weight of 333.41 g/mol. Its IUPAC name is propan-2-yl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate.
| Compound Name | propan-2-yl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
|---|---|
| PubChem CID | 897188 |
| Molecular Formula | C17H19NO4S |
| Molecular Weight | 333.41 g/mol |
| Exact Mass | 333.10 |
| IUPAC Name | propan-2-yl 2-[[(E)-3-(furan-2-yl)prop-2-enoyl]amino]-4,5-dimethylthiophene-3-carboxylate |
| SMILES | Cc1sc(NC(=O)/C=C/c2ccco2)c(C(=O)OC(C)C)c1C |
| InChI | InChI=1S/C17H19NO4S/c1-10(2)22-17(20)15-11(3)12(4)23-16(15)18-14(19)8-7-13-6-5-9-21-13/h5-10H,1-4H3,(H,18,19)/b8-7+ |
| InChIKey | NXIPUDKWAFEDDR-BQYQJAHWSA-N |
| XLogP | 4.18 |
| TPSA | 68.54 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.41 |
| LogP ≤ 5 | 4.18 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|