C16H16N2OS2 — CID 8972326
(2S)-N-(3-cyanothiophen-2-yl)-2-[(2-methylphenyl)methylsulfanyl]propanamide (PubChem CID 8972326) has the molecular formula C16H16N2OS2 and a molecular weight of 316.45 g/mol. Its IUPAC name is (2S)-N-(3-cyanothiophen-2-yl)-2-[(2-methylphenyl)methylsulfanyl]propanamide.
| Compound Name | (2S)-N-(3-cyanothiophen-2-yl)-2-[(2-methylphenyl)methylsulfanyl]propanamide |
|---|---|
| PubChem CID | 8972326 |
| Molecular Formula | C16H16N2OS2 |
| Molecular Weight | 316.45 g/mol |
| Exact Mass | 316.07 |
| IUPAC Name | (2S)-N-(3-cyanothiophen-2-yl)-2-[(2-methylphenyl)methylsulfanyl]propanamide |
| SMILES | Cc1ccccc1CS[C@@H](C)C(=O)Nc1sccc1C#N |
| InChI | InChI=1S/C16H16N2OS2/c1-11-5-3-4-6-14(11)10-21-12(2)15(19)18-16-13(9-17)7-8-20-16/h3-8,12H,10H2,1-2H3,(H,18,19)/t12-/m0/s1 |
| InChIKey | ULIDRRKVRQQZPE-LBPRGKRZSA-N |
| XLogP | 4.19 |
| TPSA | 52.89 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.45 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |