C18H25N3O2S — CID 8980300
1-(3,4-dimethoxyphenyl)-3-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiourea (PubChem CID 8980300) has the molecular formula C18H25N3O2S and a molecular weight of 347.48 g/mol. Its IUPAC name is 1-(3,4-dimethoxyphenyl)-3-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiourea.
| Compound Name | 1-(3,4-dimethoxyphenyl)-3-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiourea |
|---|---|
| PubChem CID | 8980300 |
| Molecular Formula | C18H25N3O2S |
| Molecular Weight | 347.48 g/mol |
| Exact Mass | 347.17 |
| IUPAC Name | 1-(3,4-dimethoxyphenyl)-3-[(E)-(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]thiourea |
| SMILES | COc1ccc(NC(=S)N/N=C2/C=C(C)CC(C)(C)C2)cc1OC |
| InChI | InChI=1S/C18H25N3O2S/c1-12-8-14(11-18(2,3)10-12)20-21-17(24)19-13-6-7-15(22-4)16(9-13)23-5/h6-9H,10-11H2,1-5H3,(H2,19,21,24)/b20-14- |
| InChIKey | DOWLNJYGLUQJMF-ZHZULCJRSA-N |
| XLogP | 4.11 |
| TPSA | 54.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 347.48 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|