C19H26N2O4 — CID 5201233
3,4,5-trimethoxy-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]benzamide (PubChem CID 5201233) has the molecular formula C19H26N2O4 and a molecular weight of 346.43 g/mol. Its IUPAC name is 3,4,5-trimethoxy-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]benzamide.
| Compound Name | 3,4,5-trimethoxy-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]benzamide |
|---|---|
| PubChem CID | 5201233 |
| Molecular Formula | C19H26N2O4 |
| Molecular Weight | 346.43 g/mol |
| Exact Mass | 346.19 |
| IUPAC Name | 3,4,5-trimethoxy-N-[(3,5,5-trimethylcyclohex-2-en-1-ylidene)amino]benzamide |
| SMILES | COc1cc(C(=O)NN=C2C=C(C)CC(C)(C)C2)cc(OC)c1OC |
| InChI | InChI=1S/C19H26N2O4/c1-12-7-14(11-19(2,3)10-12)20-21-18(22)13-8-15(23-4)17(25-6)16(9-13)24-5/h7-9H,10-11H2,1-6H3,(H,21,22) |
| InChIKey | TVSFVURMXLBKJA-UHFFFAOYSA-N |
| XLogP | 3.56 |
| TPSA | 69.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.43 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|