C17H15FN4S — CID 8982388
N-(cyclopentylideneamino)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine (PubChem CID 8982388) has the molecular formula C17H15FN4S and a molecular weight of 326.40 g/mol. Its IUPAC name is N-(cyclopentylideneamino)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine.
| Compound Name | N-(cyclopentylideneamino)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
|---|---|
| PubChem CID | 8982388 |
| Molecular Formula | C17H15FN4S |
| Molecular Weight | 326.40 g/mol |
| Exact Mass | 326.10 |
| IUPAC Name | N-(cyclopentylideneamino)-5-(4-fluorophenyl)thieno[2,3-d]pyrimidin-4-amine |
| SMILES | Fc1ccc(-c2csc3ncnc(NN=C4CCCC4)c23)cc1 |
| InChI | InChI=1S/C17H15FN4S/c18-12-7-5-11(6-8-12)14-9-23-17-15(14)16(19-10-20-17)22-21-13-3-1-2-4-13/h5-10H,1-4H2,(H,19,20,22) |
| InChIKey | CCMUVEBUNRKPID-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 50.17 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 326.40 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|